C38H28F6O4 — CID 155197215
7-O-[4-(3,4-difluorophenyl)-3-fluorophenyl] 1-O-[4-[4-(3,4-difluorophenyl)phenyl]-3-(fluoromethyl)phenyl] heptanedioate (PubChem CID 155197215) has the molecular formula C38H28F6O4 and a molecular weight of 662.63 g/mol. Its IUPAC name is 7-O-[4-(3,4-difluorophenyl)-3-fluorophenyl] 1-O-[4-[4-(3,4-difluorophenyl)phenyl]-3-(fluoromethyl)phenyl] heptanedioate.
| Compound Name | 7-O-[4-(3,4-difluorophenyl)-3-fluorophenyl] 1-O-[4-[4-(3,4-difluorophenyl)phenyl]-3-(fluoromethyl)phenyl] heptanedioate |
|---|---|
| PubChem CID | 155197215 |
| Molecular Formula | C38H28F6O4 |
| Molecular Weight | 662.63 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | 7-O-[4-(3,4-difluorophenyl)-3-fluorophenyl] 1-O-[4-[4-(3,4-difluorophenyl)phenyl]-3-(fluoromethyl)phenyl] heptanedioate |
| SMILES | O=C(CCCCCC(=O)Oc1ccc(-c2ccc(-c3ccc(F)c(F)c3)cc2)c(CF)c1)Oc1ccc(-c2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C38H28F6O4/c39-22-27-18-28(12-14-30(27)24-8-6-23(7-9-24)25-10-16-32(40)35(43)19-25)47-37(45)4-2-1-3-5-38(46)48-29-13-15-31(34(42)21-29)26-11-17-33(41)36(44)20-26/h6-21H,1-5,22H2 |
| InChIKey | RSYQCBFNXQGOLT-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.63 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|