C38H32F6O2 — CID 142370445
1-(3,4-difluorophenyl)-4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorobenzene;formaldehyde (PubChem CID 142370445) has the molecular formula C38H32F6O2 and a molecular weight of 634.66 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorobenzene;formaldehyde.
| Compound Name | 1-(3,4-difluorophenyl)-4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorobenzene;formaldehyde |
|---|---|
| PubChem CID | 142370445 |
| Molecular Formula | C38H32F6O2 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorobenzene;formaldehyde |
| SMILES | C=O.Fc1ccc(-c2ccc(CCCCCCCOc3ccc(-c4ccc(-c5ccc(F)c(F)c5)c(F)c4)cc3)cc2F)cc1F |
| InChI | InChI=1S/C37H30F6O.CH2O/c38-32-17-11-27(22-36(32)42)30-15-7-24(20-34(30)40)6-4-2-1-3-5-19-44-29-13-8-25(9-14-29)26-10-16-31(35(41)21-26)28-12-18-33(39)37(43)23-28;1-2/h7-18,20-23H,1-6,19H2;1H2 |
| InChIKey | WVPFDVQFDMITKF-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|