C37H29F7O — CID 142526189
5-[4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 142526189) has the molecular formula C37H29F7O and a molecular weight of 622.62 g/mol. Its IUPAC name is 5-[4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 142526189 |
| Molecular Formula | C37H29F7O |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 5-[4-[4-[7-[4-(3,4-difluorophenyl)-3-fluorophenyl]heptoxy]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | Fc1ccc(-c2ccc(CCCCCCCOc3ccc(-c4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)cc3)cc2F)cc1F |
| InChI | InChI=1S/C37H29F7O/c38-31-16-11-26(20-34(31)41)29-14-7-23(18-32(29)39)6-4-2-1-3-5-17-45-28-12-8-24(9-13-28)25-10-15-30(33(40)19-25)27-21-35(42)37(44)36(43)22-27/h7-16,18-22H,1-6,17H2 |
| InChIKey | NELYFJCWWGGNIG-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|