C33H30F6O2 — CID 102036463
1,2,3-trifluoro-5-[4-[9-[4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene (PubChem CID 102036463) has the molecular formula C33H30F6O2 and a molecular weight of 572.59 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[9-[4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[9-[4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene |
|---|---|
| PubChem CID | 102036463 |
| Molecular Formula | C33H30F6O2 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[9-[4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene |
| SMILES | Fc1cc(-c2ccc(OCCCCCCCCCOc3ccc(-c4cc(F)c(F)c(F)c4)cc3)cc2)cc(F)c1F |
| InChI | InChI=1S/C33H30F6O2/c34-28-18-24(19-29(35)32(28)38)22-8-12-26(13-9-22)40-16-6-4-2-1-3-5-7-17-41-27-14-10-23(11-15-27)25-20-30(36)33(39)31(37)21-25/h8-15,18-21H,1-7,16-17H2 |
| InChIKey | JQPZVNRAJWFFHI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|