C24H12F6 — CID 154500578
1,2,3-trifluoro-5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]benzene (PubChem CID 154500578) has the molecular formula C24H12F6 and a molecular weight of 414.35 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 154500578 |
| Molecular Formula | C24H12F6 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]benzene |
| SMILES | Fc1cc(-c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)cc3)cc2)cc(F)c1F |
| InChI | InChI=1S/C24H12F6/c25-19-9-17(10-20(26)23(19)29)15-5-1-13(2-6-15)14-3-7-16(8-4-14)18-11-21(27)24(30)22(28)12-18/h1-12H |
| InChIKey | NPURNWGNHVPWJY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|