About 2-chloro-4-(3,4,5-trifluorophenyl)phenol
2-chloro-4-(3,4,5-trifluorophenyl)phenol (PubChem CID 83130414) has the molecular formula C12H6ClF3O
and a molecular weight of 258.63 g/mol. Its IUPAC name is 2-chloro-4-(3,4,5-trifluorophenyl)phenol.
Molecular Properties
| Compound Name | 2-chloro-4-(3,4,5-trifluorophenyl)phenol |
| PubChem CID | 83130414 |
| Molecular Formula | C12H6ClF3O |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-chloro-4-(3,4,5-trifluorophenyl)phenol |
| SMILES | Oc1ccc(-c2cc(F)c(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C12H6ClF3O/c13-8-3-6(1-2-11(8)17)7-4-9(14)12(16)10(15)5-7/h1-5,17H |
| InChIKey | ISNHPIZODJJKDI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(3,4,5-trifluorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3,4,5-trifluorophenyl)phenol?
The IUPAC name of 2-chloro-4-(3,4,5-trifluorophenyl)phenol (CID 83130414) is 2-chloro-4-(3,4,5-trifluorophenyl)phenol.
What is the SMILES notation for 2-chloro-4-(3,4,5-trifluorophenyl)phenol?
The canonical SMILES for 2-chloro-4-(3,4,5-trifluorophenyl)phenol is Oc1ccc(-c2cc(F)c(F)c(F)c2)cc1Cl.
What is the InChIKey of 2-chloro-4-(3,4,5-trifluorophenyl)phenol?
The InChIKey is ISNHPIZODJJKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClF3O/c13-8-3-6(1-2-11(8)17)7-4-9(14)12(16)10(15)5-7/h1-5,17H.
What are the key properties of 2-chloro-4-(3,4,5-trifluorophenyl)phenol?
2-chloro-4-(3,4,5-trifluorophenyl)phenol has a molecular weight of 258.63 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3,4,5-trifluorophenyl)phenol is sourced from PubChem (CID 83130414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).