C18H15F3O — CID 143846486
ethane;6-(3,4,5-trifluorophenyl)naphthalen-2-ol (PubChem CID 143846486) has the molecular formula C18H15F3O and a molecular weight of 304.31 g/mol. Its IUPAC name is ethane;6-(3,4,5-trifluorophenyl)naphthalen-2-ol.
| Compound Name | ethane;6-(3,4,5-trifluorophenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 143846486 |
| Molecular Formula | C18H15F3O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | ethane;6-(3,4,5-trifluorophenyl)naphthalen-2-ol |
| SMILES | CC.Oc1ccc2cc(-c3cc(F)c(F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C16H9F3O.C2H6/c17-14-7-12(8-15(18)16(14)19)10-1-2-11-6-13(20)4-3-9(11)5-10;1-2/h1-8,20H;1-2H3 |
| InChIKey | DBIZNJKMHKNBMA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|