C13H7ClF2O2 — CID 58978552
2-chloro-4-(3,5-difluoro-4-hydroxyphenyl)benzaldehyde (PubChem CID 58978552) has the molecular formula C13H7ClF2O2 and a molecular weight of 268.65 g/mol. Its IUPAC name is 2-chloro-4-(3,5-difluoro-4-hydroxyphenyl)benzaldehyde.
| Compound Name | 2-chloro-4-(3,5-difluoro-4-hydroxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 58978552 |
| Molecular Formula | C13H7ClF2O2 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-chloro-4-(3,5-difluoro-4-hydroxyphenyl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc(F)c(O)c(F)c2)cc1Cl |
| InChI | InChI=1S/C13H7ClF2O2/c14-10-3-7(1-2-8(10)6-17)9-4-11(15)13(18)12(16)5-9/h1-6,18H |
| InChIKey | SZUBSPBGHSGOLN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|