C35H32F8O4 — CID 118245658
2-fluoro-4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]-1-(trifluoromethoxy)benzene (PubChem CID 118245658) has the molecular formula C35H32F8O4 and a molecular weight of 668.62 g/mol. Its IUPAC name is 2-fluoro-4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118245658 |
| Molecular Formula | C35H32F8O4 |
| Molecular Weight | 668.62 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 2-fluoro-4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]-1-(trifluoromethoxy)benzene |
| SMILES | Fc1cc(-c2ccc(OCCCCCCCCCOc3ccc(-c4ccc(OC(F)(F)F)c(F)c4)cc3)cc2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C35H32F8O4/c36-30-22-26(12-18-32(30)46-34(38,39)40)24-8-14-28(15-9-24)44-20-6-4-2-1-3-5-7-21-45-29-16-10-25(11-17-29)27-13-19-33(31(37)23-27)47-35(41,42)43/h8-19,22-23H,1-7,20-21H2 |
| InChIKey | OKBNZNJQVWVWJZ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.62 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|