C35H33F4NO3 — CID 118245666
4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]benzonitrile (PubChem CID 118245666) has the molecular formula C35H33F4NO3 and a molecular weight of 591.65 g/mol. Its IUPAC name is 4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 118245666 |
| Molecular Formula | C35H33F4NO3 |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 4-[4-[9-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenoxy]nonoxy]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCCCCOc3ccc(-c4ccc(OC(F)(F)F)c(F)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H33F4NO3/c36-33-24-30(16-21-34(33)43-35(37,38)39)29-14-19-32(20-15-29)42-23-7-5-3-1-2-4-6-22-41-31-17-12-28(13-18-31)27-10-8-26(25-40)9-11-27/h8-21,24H,1-7,22-23H2 |
| InChIKey | DUHFGGQVBZRSRN-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|