C34H31F4NO3 — CID 59583309
2-fluoro-4-[4-[8-[4-(4-isocyanophenyl)phenoxy]octoxy]phenyl]-1-(trifluoromethoxy)benzene (PubChem CID 59583309) has the molecular formula C34H31F4NO3 and a molecular weight of 577.62 g/mol. Its IUPAC name is 2-fluoro-4-[4-[8-[4-(4-isocyanophenyl)phenoxy]octoxy]phenyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-[8-[4-(4-isocyanophenyl)phenoxy]octoxy]phenyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 59583309 |
| Molecular Formula | C34H31F4NO3 |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-fluoro-4-[4-[8-[4-(4-isocyanophenyl)phenoxy]octoxy]phenyl]-1-(trifluoromethoxy)benzene |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(OCCCCCCCCOc3ccc(-c4ccc(OC(F)(F)F)c(F)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H31F4NO3/c1-39-29-15-8-25(9-16-29)26-10-17-30(18-11-26)40-22-6-4-2-3-5-7-23-41-31-19-12-27(13-20-31)28-14-21-33(32(35)24-28)42-34(36,37)38/h8-21,24H,2-7,22-23H2 |
| InChIKey | AYQAISHDRBJXTO-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|