C33H28F8O2 — CID 59583290
1,2,3-trifluoro-5-[2-fluoro-4-[9-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene (PubChem CID 59583290) has the molecular formula C33H28F8O2 and a molecular weight of 608.57 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-[9-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-[9-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene |
|---|---|
| PubChem CID | 59583290 |
| Molecular Formula | C33H28F8O2 |
| Molecular Weight | 608.57 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-[9-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]nonoxy]phenyl]benzene |
| SMILES | Fc1cc(OCCCCCCCCCOc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)ccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C33H28F8O2/c34-26-18-22(8-10-24(26)20-14-28(36)32(40)29(37)15-20)42-12-6-4-2-1-3-5-7-13-43-23-9-11-25(27(35)19-23)21-16-30(38)33(41)31(39)17-21/h8-11,14-19H,1-7,12-13H2 |
| InChIKey | FITIBKKVRQJLOR-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.57 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|