C47H44F4O2 — CID 118260681
2-fluoro-4-[9-[3-fluoro-4-[4-(4-fluorophenyl)-3-methylphenyl]phenoxy]nonoxy]-1-[4-(4-fluorophenyl)-3-methylphenyl]benzene (PubChem CID 118260681) has the molecular formula C47H44F4O2 and a molecular weight of 716.86 g/mol. Its IUPAC name is 2-fluoro-4-[9-[3-fluoro-4-[4-(4-fluorophenyl)-3-methylphenyl]phenoxy]nonoxy]-1-[4-(4-fluorophenyl)-3-methylphenyl]benzene.
| Compound Name | 2-fluoro-4-[9-[3-fluoro-4-[4-(4-fluorophenyl)-3-methylphenyl]phenoxy]nonoxy]-1-[4-(4-fluorophenyl)-3-methylphenyl]benzene |
|---|---|
| PubChem CID | 118260681 |
| Molecular Formula | C47H44F4O2 |
| Molecular Weight | 716.86 g/mol |
| Exact Mass | 716.33 |
| IUPAC Name | 2-fluoro-4-[9-[3-fluoro-4-[4-(4-fluorophenyl)-3-methylphenyl]phenoxy]nonoxy]-1-[4-(4-fluorophenyl)-3-methylphenyl]benzene |
| SMILES | Cc1cc(-c2ccc(OCCCCCCCCCOc3ccc(-c4ccc(-c5ccc(F)cc5)c(C)c4)c(F)c3)cc2F)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C47H44F4O2/c1-32-28-36(14-22-42(32)34-10-16-38(48)17-11-34)44-24-20-40(30-46(44)50)52-26-8-6-4-3-5-7-9-27-53-41-21-25-45(47(51)31-41)37-15-23-43(33(2)29-37)35-12-18-39(49)19-13-35/h10-25,28-31H,3-9,26-27H2,1-2H3 |
| InChIKey | DZOFWHZZUURLAH-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.86 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|