C41H28F2N2O2 — CID 118260658
4-[4-[4-[[4-[4-(4-cyanophenyl)-3-methylphenyl]-3-fluorophenoxy]methoxy]-2-fluorophenyl]-2-methylphenyl]benzonitrile (PubChem CID 118260658) has the molecular formula C41H28F2N2O2 and a molecular weight of 618.68 g/mol. Its IUPAC name is 4-[4-[4-[[4-[4-(4-cyanophenyl)-3-methylphenyl]-3-fluorophenoxy]methoxy]-2-fluorophenyl]-2-methylphenyl]benzonitrile.
| Compound Name | 4-[4-[4-[[4-[4-(4-cyanophenyl)-3-methylphenyl]-3-fluorophenoxy]methoxy]-2-fluorophenyl]-2-methylphenyl]benzonitrile |
|---|---|
| PubChem CID | 118260658 |
| Molecular Formula | C41H28F2N2O2 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 4-[4-[4-[[4-[4-(4-cyanophenyl)-3-methylphenyl]-3-fluorophenoxy]methoxy]-2-fluorophenyl]-2-methylphenyl]benzonitrile |
| SMILES | Cc1cc(-c2ccc(OCOc3ccc(-c4ccc(-c5ccc(C#N)cc5)c(C)c4)c(F)c3)cc2F)ccc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C41H28F2N2O2/c1-26-19-32(11-15-36(26)30-7-3-28(23-44)4-8-30)38-17-13-34(21-40(38)42)46-25-47-35-14-18-39(41(43)22-35)33-12-16-37(27(2)20-33)31-9-5-29(24-45)6-10-31/h3-22H,25H2,1-2H3 |
| InChIKey | DCFBGFFFMUDYKJ-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|