C25H18F6O3 — CID 59725302
4-[3,4-bis(3,4,5-trifluorophenyl)phenoxy]butyl prop-2-enoate (PubChem CID 59725302) has the molecular formula C25H18F6O3 and a molecular weight of 480.40 g/mol. Its IUPAC name is 4-[3,4-bis(3,4,5-trifluorophenyl)phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[3,4-bis(3,4,5-trifluorophenyl)phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 59725302 |
| Molecular Formula | C25H18F6O3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-[3,4-bis(3,4,5-trifluorophenyl)phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2cc(F)c(F)c(F)c2)c(-c2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C25H18F6O3/c1-2-23(32)34-8-4-3-7-33-16-5-6-17(14-9-19(26)24(30)20(27)10-14)18(13-16)15-11-21(28)25(31)22(29)12-15/h2,5-6,9-13H,1,3-4,7-8H2 |
| InChIKey | AVRRJSAWGPKKHE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|