C14H17FO3 — CID 59747405
4-(3-fluoro-4-methylphenoxy)butyl prop-2-enoate (PubChem CID 59747405) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 4-(3-fluoro-4-methylphenoxy)butyl prop-2-enoate.
| Compound Name | 4-(3-fluoro-4-methylphenoxy)butyl prop-2-enoate |
|---|---|
| PubChem CID | 59747405 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-(3-fluoro-4-methylphenoxy)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C14H17FO3/c1-3-14(16)18-9-5-4-8-17-12-7-6-11(2)13(15)10-12/h3,6-7,10H,1,4-5,8-9H2,2H3 |
| InChIKey | VCNHAVKSWHDQMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|