C16H19FO4 — CID 174332719
6-(3-fluoro-4-formylphenoxy)hexyl prop-2-enoate (PubChem CID 174332719) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 6-(3-fluoro-4-formylphenoxy)hexyl prop-2-enoate.
| Compound Name | 6-(3-fluoro-4-formylphenoxy)hexyl prop-2-enoate |
|---|---|
| PubChem CID | 174332719 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 6-(3-fluoro-4-formylphenoxy)hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C=O)c(F)c1 |
| InChI | InChI=1S/C16H19FO4/c1-2-16(19)21-10-6-4-3-5-9-20-14-8-7-13(12-18)15(17)11-14/h2,7-8,11-12H,1,3-6,9-10H2 |
| InChIKey | RZKJQEVUCJAYIT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|