C51H52F2O10 — CID 118027453
[7-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoyloxy]-9,9-dimethylfluoren-2-yl] 3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate (PubChem CID 118027453) has the molecular formula C51H52F2O10 and a molecular weight of 862.96 g/mol. Its IUPAC name is [7-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoyloxy]-9,9-dimethylfluoren-2-yl] 3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate.
| Compound Name | [7-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoyloxy]-9,9-dimethylfluoren-2-yl] 3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 118027453 |
| Molecular Formula | C51H52F2O10 |
| Molecular Weight | 862.96 g/mol |
| Exact Mass | 862.35 |
| IUPAC Name | [7-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoyloxy]-9,9-dimethylfluoren-2-yl] 3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C=CC(=O)Oc2ccc3c(c2)C(C)(C)c2cc(OC(=O)C=Cc4ccc(OCCCCCCOC(=O)C=C)cc4F)ccc2-3)c(F)c1 |
| InChI | InChI=1S/C51H52F2O10/c1-5-47(54)60-29-13-9-7-11-27-58-37-19-15-35(45(52)33-37)17-25-49(56)62-39-21-23-41-42-24-22-40(32-44(42)51(3,4)43(41)31-39)63-50(57)26-18-36-16-20-38(34-46(36)53)59-28-12-8-10-14-30-61-48(55)6-2/h5-6,15-26,31-34H,1-2,7-14,27-30H2,3-4H3 |
| InChIKey | NQGMXRWXTCGYPL-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.96 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|