C51H58O10 — CID 121311031
[9,9-dimethyl-7-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]fluoren-2-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate (PubChem CID 121311031) has the molecular formula C51H58O10 and a molecular weight of 831.01 g/mol. Its IUPAC name is [9,9-dimethyl-7-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]fluoren-2-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate.
| Compound Name | [9,9-dimethyl-7-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]fluoren-2-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 121311031 |
| Molecular Formula | C51H58O10 |
| Molecular Weight | 831.01 g/mol |
| Exact Mass | 830.40 |
| IUPAC Name | [9,9-dimethyl-7-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]fluoren-2-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCC(=O)Oc2ccc3c(c2)C(C)(C)c2cc(OC(=O)CCc4ccc(OCCCCCCOC(=O)C=C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C51H58O10/c1-5-47(52)58-33-13-9-7-11-31-56-39-21-15-37(16-22-39)19-29-49(54)60-41-25-27-43-44-28-26-42(36-46(44)51(3,4)45(43)35-41)61-50(55)30-20-38-17-23-40(24-18-38)57-32-12-8-10-14-34-59-48(53)6-2/h5-6,15-18,21-28,35-36H,1-2,7-14,19-20,29-34H2,3-4H3 |
| InChIKey | UWDDCGCOAUBEPY-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.01 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|