C34H38O9S — CID 59747450
[4-[4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenyl]sulfonylphenyl] butanoate (PubChem CID 59747450) has the molecular formula C34H38O9S and a molecular weight of 622.74 g/mol. Its IUPAC name is [4-[4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenyl]sulfonylphenyl] butanoate.
| Compound Name | [4-[4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenyl]sulfonylphenyl] butanoate |
|---|---|
| PubChem CID | 59747450 |
| Molecular Formula | C34H38O9S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [4-[4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenyl]sulfonylphenyl] butanoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCC(=O)Oc2ccc(S(=O)(=O)c3ccc(OC(=O)CCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H38O9S/c1-3-9-33(36)42-28-15-19-30(20-16-28)44(38,39)31-21-17-29(18-22-31)43-34(37)23-12-26-10-13-27(14-11-26)40-24-7-5-6-8-25-41-32(35)4-2/h4,10-11,13-22H,2-3,5-9,12,23-25H2,1H3 |
| InChIKey | AMBXJQBBFTUKSC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|