C17H22O4 — CID 21049752
(4-methylphenyl) 7-prop-2-enoyloxyheptanoate (PubChem CID 21049752) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (4-methylphenyl) 7-prop-2-enoyloxyheptanoate.
| Compound Name | (4-methylphenyl) 7-prop-2-enoyloxyheptanoate |
|---|---|
| PubChem CID | 21049752 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (4-methylphenyl) 7-prop-2-enoyloxyheptanoate |
| SMILES | C=CC(=O)OCCCCCCC(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O4/c1-3-16(18)20-13-7-5-4-6-8-17(19)21-15-11-9-14(2)10-12-15/h3,9-12H,1,4-8,13H2,2H3 |
| InChIKey | SROCJRBRMFSAKV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|