C21H28O6 — CID 121441027
[4-(6-prop-2-enoyloxyhexoxy)phenyl] 6-oxohexanoate (PubChem CID 121441027) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)phenyl] 6-oxohexanoate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 6-oxohexanoate |
|---|---|
| PubChem CID | 121441027 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 6-oxohexanoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)CCCCC=O)cc1 |
| InChI | InChI=1S/C21H28O6/c1-2-20(23)26-17-9-4-3-8-16-25-18-11-13-19(14-12-18)27-21(24)10-6-5-7-15-22/h2,11-15H,1,3-10,16-17H2 |
| InChIKey | HJGSUDXHHFRUAE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|