C29H34O9 — CID 141275696
[4-(4-ethoxy-4-oxobutoxy)carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 141275696) has the molecular formula C29H34O9 and a molecular weight of 526.58 g/mol. Its IUPAC name is [4-(4-ethoxy-4-oxobutoxy)carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(4-ethoxy-4-oxobutoxy)carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 141275696 |
| Molecular Formula | C29H34O9 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [4-(4-ethoxy-4-oxobutoxy)carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OCCCC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C29H34O9/c1-3-26(30)36-20-8-6-5-7-19-35-24-15-11-23(12-16-24)29(33)38-25-17-13-22(14-18-25)28(32)37-21-9-10-27(31)34-4-2/h3,11-18H,1,4-10,19-21H2,2H3 |
| InChIKey | DVQRZZDCXVQCSF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|