C36H38O10 — CID 59609237
[4-(4-hexanoyloxybenzoyl)oxy-3-methylphenyl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate (PubChem CID 59609237) has the molecular formula C36H38O10 and a molecular weight of 630.69 g/mol. Its IUPAC name is [4-(4-hexanoyloxybenzoyl)oxy-3-methylphenyl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate.
| Compound Name | [4-(4-hexanoyloxybenzoyl)oxy-3-methylphenyl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate |
|---|---|
| PubChem CID | 59609237 |
| Molecular Formula | C36H38O10 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | [4-(4-hexanoyloxybenzoyl)oxy-3-methylphenyl] 4-(6-prop-2-enoyloxyhexanoyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCCC(=O)Oc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(=O)CCCCC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C36H38O10/c1-4-6-8-11-33(38)43-29-19-15-27(16-20-29)36(41)46-31-22-21-30(24-25(31)3)45-35(40)26-13-17-28(18-14-26)44-34(39)12-9-7-10-23-42-32(37)5-2/h5,13-22,24H,2,4,6-12,23H2,1,3H3 |
| InChIKey | LDGZELJPCNMXDT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|