C43H36O12 — CID 59582810
[3-methyl-4-[6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(2-prop-2-enoyloxyacetyl)oxynaphthalene-2-carboxylate (PubChem CID 59582810) has the molecular formula C43H36O12 and a molecular weight of 744.75 g/mol. Its IUPAC name is [3-methyl-4-[6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(2-prop-2-enoyloxyacetyl)oxynaphthalene-2-carboxylate.
| Compound Name | [3-methyl-4-[6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(2-prop-2-enoyloxyacetyl)oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59582810 |
| Molecular Formula | C43H36O12 |
| Molecular Weight | 744.75 g/mol |
| Exact Mass | 744.22 |
| IUPAC Name | [3-methyl-4-[6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carbonyl]oxyphenyl] 6-(2-prop-2-enoyloxyacetyl)oxynaphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCC(=O)Oc1ccc2cc(C(=O)Oc3ccc(OC(=O)c4ccc5cc(OC(=O)COC(=O)C=C)ccc5c4)cc3C)ccc2c1 |
| InChI | InChI=1S/C43H36O12/c1-4-38(44)50-20-8-6-7-9-40(46)52-35-16-14-29-23-33(13-11-30(29)24-35)43(49)55-37-19-18-34(21-27(37)3)54-42(48)32-12-10-31-25-36(17-15-28(31)22-32)53-41(47)26-51-39(45)5-2/h4-5,10-19,21-25H,1-2,6-9,20,26H2,3H3 |
| InChIKey | MIDYAAOMSZULCH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|