C55H66O12 — CID 58141855
[4-[4-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]but-1-en-2-yloxy]-3-methylphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate (PubChem CID 58141855) has the molecular formula C55H66O12 and a molecular weight of 919.12 g/mol. Its IUPAC name is [4-[4-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]but-1-en-2-yloxy]-3-methylphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate.
| Compound Name | [4-[4-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]but-1-en-2-yloxy]-3-methylphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58141855 |
| Molecular Formula | C55H66O12 |
| Molecular Weight | 919.12 g/mol |
| Exact Mass | 918.46 |
| IUPAC Name | [4-[4-[3,4-bis(6-prop-2-enoyloxyhexoxy)phenyl]but-1-en-2-yloxy]-3-methylphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C(=O)Oc3ccc(OC(=C)CCc4ccc(OCCCCCCOC(=O)C=C)c(OCCCCCCOC(=O)C=C)c4)c(C)c3)ccc2c1 |
| InChI | InChI=1S/C55H66O12/c1-6-52(56)63-34-18-12-9-15-31-60-47-27-26-44-39-46(25-24-45(44)40-47)55(59)67-48-28-30-49(41(4)37-48)66-42(5)21-22-43-23-29-50(61-32-16-10-13-19-35-64-53(57)7-2)51(38-43)62-33-17-11-14-20-36-65-54(58)8-3/h6-8,23-30,37-40H,1-3,5,9-22,31-36H2,4H3 |
| InChIKey | RZZPBDDQNUNDBG-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.12 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|