C30H38O5 — CID 118100050
[4-(4-propylcyclohexyl)phenyl] 3-[4-(3-prop-2-enoyloxypropoxy)phenyl]propanoate (PubChem CID 118100050) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is [4-(4-propylcyclohexyl)phenyl] 3-[4-(3-prop-2-enoyloxypropoxy)phenyl]propanoate.
| Compound Name | [4-(4-propylcyclohexyl)phenyl] 3-[4-(3-prop-2-enoyloxypropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 118100050 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [4-(4-propylcyclohexyl)phenyl] 3-[4-(3-prop-2-enoyloxypropoxy)phenyl]propanoate |
| SMILES | C=CC(=O)OCCCOc1ccc(CCC(=O)Oc2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H38O5/c1-3-6-23-7-12-25(13-8-23)26-14-18-28(19-15-26)35-30(32)20-11-24-9-16-27(17-10-24)33-21-5-22-34-29(31)4-2/h4,9-10,14-19,23,25H,2-3,5-8,11-13,20-22H2,1H3 |
| InChIKey | BRTUHRDUEWTISA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|