C31H28O9 — CID 170841969
[4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate (PubChem CID 170841969) has the molecular formula C31H28O9 and a molecular weight of 544.56 g/mol. Its IUPAC name is [4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate.
| Compound Name | [4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
|---|---|
| PubChem CID | 170841969 |
| Molecular Formula | C31H28O9 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [4-[3-(4-prop-2-enoyloxyphenyl)propanoyloxy]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(OC(=O)CCc3ccc(OC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H28O9/c1-3-28(32)37-21-5-20-36-24-13-9-23(10-14-24)31(35)40-27-17-15-26(16-18-27)39-30(34)19-8-22-6-11-25(12-7-22)38-29(33)4-2/h3-4,6-7,9-18H,1-2,5,8,19-21H2 |
| InChIKey | OPQVNRVPQLTTTJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|