C25H24O10 — CID 168764561
4-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenoxy]carbonylbenzoic acid (PubChem CID 168764561) has the molecular formula C25H24O10 and a molecular weight of 484.46 g/mol. Its IUPAC name is 4-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenoxy]carbonylbenzoic acid.
| Compound Name | 4-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 168764561 |
| Molecular Formula | C25H24O10 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-[4-[2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoyl]oxyethyl]phenoxy]carbonylbenzoic acid |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)OCCc1ccc(OC(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H24O10/c1-2-21(26)33-15-16-34-23(28)12-11-22(27)32-14-13-17-3-9-20(10-4-17)35-25(31)19-7-5-18(6-8-19)24(29)30/h2-10H,1,11-16H2,(H,29,30) |
| InChIKey | UPLPWRBUDOETHE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|