C26H38O2 — CID 59695683
5-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pent-1-en-3-one (PubChem CID 59695683) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 5-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pent-1-en-3-one.
| Compound Name | 5-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pent-1-en-3-one |
|---|---|
| PubChem CID | 59695683 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 5-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pent-1-en-3-one |
| SMILES | C=CC(=O)CCOc1ccc(C2CCC(C3CCC(CCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H38O2/c1-3-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-14-16-26(17-15-24)28-19-18-25(27)4-2/h4,14-17,20-23H,2-3,5-13,18-19H2,1H3 |
| InChIKey | DXSOAMMJRFIPTQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|