C40H46I2O4 — CID 161378035
molecular iodine;[4-[2-(4-pentylphenyl)ethynyl]phenyl] prop-2-enoate;[4-(4-propylcyclohexyl)phenyl] prop-2-enoate (PubChem CID 161378035) has the molecular formula C40H46I2O4 and a molecular weight of 844.61 g/mol. Its IUPAC name is molecular iodine;[4-[2-(4-pentylphenyl)ethynyl]phenyl] prop-2-enoate;[4-(4-propylcyclohexyl)phenyl] prop-2-enoate.
| Compound Name | molecular iodine;[4-[2-(4-pentylphenyl)ethynyl]phenyl] prop-2-enoate;[4-(4-propylcyclohexyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 161378035 |
| Molecular Formula | C40H46I2O4 |
| Molecular Weight | 844.61 g/mol |
| Exact Mass | 844.15 |
| IUPAC Name | molecular iodine;[4-[2-(4-pentylphenyl)ethynyl]phenyl] prop-2-enoate;[4-(4-propylcyclohexyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2ccc(CCCCC)cc2)cc1.C=CC(=O)Oc1ccc(C2CCC(CCC)CC2)cc1.II |
| InChI | InChI=1S/C22H22O2.C18H24O2.I2/c1-3-5-6-7-18-8-10-19(11-9-18)12-13-20-14-16-21(17-15-20)24-22(23)4-2;1-3-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)20-18(19)4-2;1-2/h4,8-11,14-17H,2-3,5-7H2,1H3;4,10-15H,2-3,5-9H2,1H3; |
| InChIKey | VRILRIPAPFHDMK-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.61 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|