C55H57NO12 — CID 149057594
[6-(4-hydroxyphenoxy)-3-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenanthridin-8-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate (PubChem CID 149057594) has the molecular formula C55H57NO12 and a molecular weight of 924.06 g/mol. Its IUPAC name is [6-(4-hydroxyphenoxy)-3-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenanthridin-8-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate.
| Compound Name | [6-(4-hydroxyphenoxy)-3-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenanthridin-8-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 149057594 |
| Molecular Formula | C55H57NO12 |
| Molecular Weight | 924.06 g/mol |
| Exact Mass | 923.39 |
| IUPAC Name | [6-(4-hydroxyphenoxy)-3-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyloxy]phenanthridin-8-yl] 3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCC(=O)Oc2ccc3c(c2)nc(Oc2ccc(O)cc2)c2cc(OC(=O)CCc4ccc(OCCCCCCOC(=O)C=C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C55H57NO12/c1-3-51(58)64-35-11-7-5-9-33-62-42-21-13-39(14-22-42)17-31-53(60)66-45-27-29-47-48-30-28-46(38-50(48)56-55(49(47)37-45)68-44-25-19-41(57)20-26-44)67-54(61)32-18-40-15-23-43(24-16-40)63-34-10-6-8-12-36-65-52(59)4-2/h3-4,13-16,19-30,37-38,57H,1-2,5-12,17-18,31-36H2 |
| InChIKey | QLDKIJJCAMMPDD-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.06 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|