C43H38O2 — CID 118652531
5-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]pentyl prop-2-enoate (PubChem CID 118652531) has the molecular formula C43H38O2 and a molecular weight of 586.77 g/mol. Its IUPAC name is 5-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]pentyl prop-2-enoate.
| Compound Name | 5-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 118652531 |
| Molecular Formula | C43H38O2 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 5-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCc1ccc(-c2c3ccccc3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H38O2/c1-4-40(44)45-27-13-5-6-14-29-21-23-30(24-22-29)41-34-16-7-9-18-36(34)42(37-19-10-8-17-35(37)41)31-25-26-33-32-15-11-12-20-38(32)43(2,3)39(33)28-31/h4,7-12,15-26,28H,1,5-6,13-14,27H2,2-3H3 |
| InChIKey | LGCHIKRDLJHVQZ-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|