C46H42O2 — CID 118934471
5-[4-[4-(4-but-1-en-2-ylphenyl)-2,3-diphenylnaphthalen-1-yl]phenyl]pentyl prop-2-enoate (PubChem CID 118934471) has the molecular formula C46H42O2 and a molecular weight of 626.84 g/mol. Its IUPAC name is 5-[4-[4-(4-but-1-en-2-ylphenyl)-2,3-diphenylnaphthalen-1-yl]phenyl]pentyl prop-2-enoate.
| Compound Name | 5-[4-[4-(4-but-1-en-2-ylphenyl)-2,3-diphenylnaphthalen-1-yl]phenyl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 118934471 |
| Molecular Formula | C46H42O2 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | 5-[4-[4-(4-but-1-en-2-ylphenyl)-2,3-diphenylnaphthalen-1-yl]phenyl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(C(=C)CC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C46H42O2/c1-4-33(3)35-28-30-39(31-29-35)44-41-23-15-14-22-40(41)43(38-26-24-34(25-27-38)17-9-8-16-32-48-42(47)5-2)45(36-18-10-6-11-19-36)46(44)37-20-12-7-13-21-37/h5-7,10-15,18-31H,2-4,8-9,16-17,32H2,1H3 |
| InChIKey | INQAESVDCQTRMD-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|