C24H23NO2 — CID 142376976
4-[4-(4-pyridin-4-ylphenyl)phenyl]butyl prop-2-enoate (PubChem CID 142376976) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-[4-(4-pyridin-4-ylphenyl)phenyl]butyl prop-2-enoate.
| Compound Name | 4-[4-(4-pyridin-4-ylphenyl)phenyl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 142376976 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[4-(4-pyridin-4-ylphenyl)phenyl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1ccc(-c2ccc(-c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-2-24(26)27-18-4-3-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-25-17-15-23/h2,6-17H,1,3-5,18H2 |
| InChIKey | LAMXGSCSDDILAV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|