C42H50N2O7 — CID 143836743
6-[3-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]-5-(5-prop-2-enoyloxypentoxy)phenoxy]hexyl prop-2-enoate (PubChem CID 143836743) has the molecular formula C42H50N2O7 and a molecular weight of 694.87 g/mol. Its IUPAC name is 6-[3-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]-5-(5-prop-2-enoyloxypentoxy)phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[3-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]-5-(5-prop-2-enoyloxypentoxy)phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 143836743 |
| Molecular Formula | C42H50N2O7 |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | 6-[3-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]-5-(5-prop-2-enoyloxypentoxy)phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1cc(OCCCCCOC(=O)C=C)cc(-c2nnc(-c3ccc(-c4ccc(CCCCC)cc4)cc3)o2)c1 |
| InChI | InChI=1S/C42H50N2O7/c1-4-7-11-16-32-17-19-33(20-18-32)34-21-23-35(24-22-34)41-43-44-42(51-41)36-29-37(47-25-12-8-9-13-27-49-39(45)5-2)31-38(30-36)48-26-14-10-15-28-50-40(46)6-3/h5-6,17-24,29-31H,2-4,7-16,25-28H2,1H3 |
| InChIKey | BUZLCJBXZKMHHW-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|