C50H48O4 — CID 118934505
4-[3-[12-[3,5-bis(prop-1-en-2-yl)phenyl]chrysen-6-yl]-5-(4-prop-2-enoyloxybutyl)phenyl]butyl prop-2-enoate (PubChem CID 118934505) has the molecular formula C50H48O4 and a molecular weight of 712.93 g/mol. Its IUPAC name is 4-[3-[12-[3,5-bis(prop-1-en-2-yl)phenyl]chrysen-6-yl]-5-(4-prop-2-enoyloxybutyl)phenyl]butyl prop-2-enoate.
| Compound Name | 4-[3-[12-[3,5-bis(prop-1-en-2-yl)phenyl]chrysen-6-yl]-5-(4-prop-2-enoyloxybutyl)phenyl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 118934505 |
| Molecular Formula | C50H48O4 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | 4-[3-[12-[3,5-bis(prop-1-en-2-yl)phenyl]chrysen-6-yl]-5-(4-prop-2-enoyloxybutyl)phenyl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1cc(CCCCOC(=O)C=C)cc(-c2cc3c4ccccc4c(-c4cc(C(=C)C)cc(C(=C)C)c4)cc3c3ccccc23)c1 |
| InChI | InChI=1S/C50H48O4/c1-7-49(51)53-23-15-13-17-35-25-36(18-14-16-24-54-50(52)8-2)27-39(26-35)45-31-47-44-22-12-10-20-42(44)46(32-48(47)43-21-11-9-19-41(43)45)40-29-37(33(3)4)28-38(30-40)34(5)6/h7-12,19-22,25-32H,1-3,5,13-18,23-24H2,4,6H3 |
| InChIKey | CBEAINZGGQDTDE-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|