C21H32O3 — CID 89073143
6-[3-(6-hydroxyhexyl)phenyl]hexyl prop-2-enoate (PubChem CID 89073143) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 6-[3-(6-hydroxyhexyl)phenyl]hexyl prop-2-enoate.
| Compound Name | 6-[3-(6-hydroxyhexyl)phenyl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 89073143 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 6-[3-(6-hydroxyhexyl)phenyl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCc1cccc(CCCCCCO)c1 |
| InChI | InChI=1S/C21H32O3/c1-2-21(23)24-17-10-6-4-8-13-20-15-11-14-19(18-20)12-7-3-5-9-16-22/h2,11,14-15,18,22H,1,3-10,12-13,16-17H2 |
| InChIKey | PBYKKGUTHNYBDG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|