C20H28N2O6 — CID 122597611
4-[[3-[(2-prop-2-enoyloxyethoxyamino)methyl]phenyl]methylamino]oxybutyl prop-2-enoate (PubChem CID 122597611) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 4-[[3-[(2-prop-2-enoyloxyethoxyamino)methyl]phenyl]methylamino]oxybutyl prop-2-enoate.
| Compound Name | 4-[[3-[(2-prop-2-enoyloxyethoxyamino)methyl]phenyl]methylamino]oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 122597611 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[[3-[(2-prop-2-enoyloxyethoxyamino)methyl]phenyl]methylamino]oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCONCc1cccc(CNOCCOC(=O)C=C)c1 |
| InChI | InChI=1S/C20H28N2O6/c1-3-19(23)25-10-5-6-11-27-21-15-17-8-7-9-18(14-17)16-22-28-13-12-26-20(24)4-2/h3-4,7-9,14,21-22H,1-2,5-6,10-13,15-16H2 |
| InChIKey | ACTJZPVSBOHGHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|