C17H22N2O5 — CID 122597612
[2-[[3-(aminomethyl)phenyl]methylamino]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 122597612) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is [2-[[3-(aminomethyl)phenyl]methylamino]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[[3-(aminomethyl)phenyl]methylamino]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 122597612 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [2-[[3-(aminomethyl)phenyl]methylamino]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)ONCc1cccc(CN)c1 |
| InChI | InChI=1S/C17H22N2O5/c1-3-16(20)22-11-15(12-23-17(21)4-2)24-19-10-14-7-5-6-13(8-14)9-18/h3-8,15,19H,1-2,9-12,18H2 |
| InChIKey | YGGHWIWQLKFXAC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|