C22H28N2O7 — CID 122597609
[2-[[[3-(aminomethyl)phenyl]methylamino]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate (PubChem CID 122597609) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is [2-[[[3-(aminomethyl)phenyl]methylamino]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate.
| Compound Name | [2-[[[3-(aminomethyl)phenyl]methylamino]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 122597609 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [2-[[[3-(aminomethyl)phenyl]methylamino]oxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CONCc1cccc(CN)c1)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C22H28N2O7/c1-4-19(25)28-13-22(14-29-20(26)5-2,15-30-21(27)6-3)16-31-24-12-18-9-7-8-17(10-18)11-23/h4-10,24H,1-3,11-16,23H2 |
| InChIKey | PXRZOHJREWHDGQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|