C10H12N2O — CID 82503451
N-[4-(aminomethyl)phenyl]prop-2-enamide (PubChem CID 82503451) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(aminomethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 82503451 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CN)cc1 |
| InChI | InChI=1S/C10H12N2O/c1-2-10(13)12-9-5-3-8(7-11)4-6-9/h2-6H,1,7,11H2,(H,12,13) |
| InChIKey | LNOJQBCYGMAKKK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|