C19H19N3O4 — CID 138682756
[3-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]phenyl]carbamic acid (PubChem CID 138682756) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]phenyl]carbamic acid.
| Compound Name | [3-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 138682756 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [3-[3-[4-(prop-2-enoylamino)phenyl]propanoylamino]phenyl]carbamic acid |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)Nc2cccc(NC(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-2-17(23)20-14-9-6-13(7-10-14)8-11-18(24)21-15-4-3-5-16(12-15)22-19(25)26/h2-7,9-10,12,22H,1,8,11H2,(H,20,23)(H,21,24)(H,25,26) |
| InChIKey | CHWDZWRPDFQPGM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|