C22H21N3O2 — CID 17233492
3-phenyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide (PubChem CID 17233492) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-phenyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide.
| Compound Name | 3-phenyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 17233492 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-phenyl-N-[4-(phenylcarbamoylamino)phenyl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O2/c26-21(16-11-17-7-3-1-4-8-17)23-19-12-14-20(15-13-19)25-22(27)24-18-9-5-2-6-10-18/h1-10,12-15H,11,16H2,(H,23,26)(H2,24,25,27) |
| InChIKey | ONJNRPVKVLVVOB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |