C16H21N3O3 — CID 176658627
N-methyl-N'-[3-(prop-2-enoylamino)phenyl]hexanediamide (PubChem CID 176658627) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-methyl-N'-[3-(prop-2-enoylamino)phenyl]hexanediamide.
| Compound Name | N-methyl-N'-[3-(prop-2-enoylamino)phenyl]hexanediamide |
|---|---|
| PubChem CID | 176658627 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-methyl-N'-[3-(prop-2-enoylamino)phenyl]hexanediamide |
| SMILES | C=CC(=O)Nc1cccc(NC(=O)CCCCC(=O)NC)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-14(20)18-12-7-6-8-13(11-12)19-16(22)10-5-4-9-15(21)17-2/h3,6-8,11H,1,4-5,9-10H2,2H3,(H,17,21)(H,18,20)(H,19,22) |
| InChIKey | CRTHGPAAKQEFEK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|