C30H42N4O4 — CID 17189285
N,N'-bis[3-(2-methylpropanoylamino)phenyl]decanediamide (PubChem CID 17189285) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is N,N'-bis[3-(2-methylpropanoylamino)phenyl]decanediamide.
| Compound Name | N,N'-bis[3-(2-methylpropanoylamino)phenyl]decanediamide |
|---|---|
| PubChem CID | 17189285 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | N,N'-bis[3-(2-methylpropanoylamino)phenyl]decanediamide |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=O)CCCCCCCCC(=O)Nc2cccc(NC(=O)C(C)C)c2)c1 |
| InChI | InChI=1S/C30H42N4O4/c1-21(2)29(37)33-25-15-11-13-23(19-25)31-27(35)17-9-7-5-6-8-10-18-28(36)32-24-14-12-16-26(20-24)34-30(38)22(3)4/h11-16,19-22H,5-10,17-18H2,1-4H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | WCRXYZZMQDMRTM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|