C27H36N4O4 — CID 17188809
N,N'-bis[3-(propanoylamino)phenyl]nonanediamide (PubChem CID 17188809) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N,N'-bis[3-(propanoylamino)phenyl]nonanediamide.
| Compound Name | N,N'-bis[3-(propanoylamino)phenyl]nonanediamide |
|---|---|
| PubChem CID | 17188809 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N,N'-bis[3-(propanoylamino)phenyl]nonanediamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CCCCCCCC(=O)Nc2cccc(NC(=O)CC)c2)c1 |
| InChI | InChI=1S/C27H36N4O4/c1-3-24(32)28-20-12-10-14-22(18-20)30-26(34)16-8-6-5-7-9-17-27(35)31-23-15-11-13-21(19-23)29-25(33)4-2/h10-15,18-19H,3-9,16-17H2,1-2H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | XJMIYUFXWDFOJT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|