C20H25N3O2 — CID 54813263
N-[3-[[2-(3,5-dimethylanilino)acetyl]amino]phenyl]-2-methylpropanamide (PubChem CID 54813263) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[3-[[2-(3,5-dimethylanilino)acetyl]amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[[2-(3,5-dimethylanilino)acetyl]amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 54813263 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[3-[[2-(3,5-dimethylanilino)acetyl]amino]phenyl]-2-methylpropanamide |
| SMILES | Cc1cc(C)cc(NCC(=O)Nc2cccc(NC(=O)C(C)C)c2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-13(2)20(25)23-17-7-5-6-16(11-17)22-19(24)12-21-18-9-14(3)8-15(4)10-18/h5-11,13,21H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | YGMUKJBUKPXWTH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |