C16H19ClN2O — CID 50988159
2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride (PubChem CID 50988159) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride.
| Compound Name | 2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 50988159 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(3,5-dimethylanilino)-N-phenylacetamide;hydrochloride |
| SMILES | Cc1cc(C)cc(NCC(=O)Nc2ccccc2)c1.Cl |
| InChI | InChI=1S/C16H18N2O.ClH/c1-12-8-13(2)10-15(9-12)17-11-16(19)18-14-6-4-3-5-7-14;/h3-10,17H,11H2,1-2H3,(H,18,19);1H |
| InChIKey | RELTWIRILQPOGD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |