C15H14Br2N2O — CID 28887968
2-(2,6-dibromo-4-methylanilino)-N-phenylacetamide (PubChem CID 28887968) has the molecular formula C15H14Br2N2O and a molecular weight of 398.10 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-methylanilino)-N-phenylacetamide.
| Compound Name | 2-(2,6-dibromo-4-methylanilino)-N-phenylacetamide |
|---|---|
| PubChem CID | 28887968 |
| Molecular Formula | C15H14Br2N2O |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 2-(2,6-dibromo-4-methylanilino)-N-phenylacetamide |
| SMILES | Cc1cc(Br)c(NCC(=O)Nc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H14Br2N2O/c1-10-7-12(16)15(13(17)8-10)18-9-14(20)19-11-5-3-2-4-6-11/h2-8,18H,9H2,1H3,(H,19,20) |
| InChIKey | XPJDSUKVCQPZMV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |